C19H22N2O — CID 139697323
(6aS,9R)-7,9-dimethyl-4-prop-2-enyl-6a,8-dihydro-6H-indolo[4,3-fg]quinolin-9-ol (PubChem CID 139697323) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (6aS,9R)-7,9-dimethyl-4-prop-2-enyl-6a,8-dihydro-6H-indolo[4,3-fg]quinolin-9-ol.
| Compound Name | (6aS,9R)-7,9-dimethyl-4-prop-2-enyl-6a,8-dihydro-6H-indolo[4,3-fg]quinolin-9-ol |
|---|---|
| PubChem CID | 139697323 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (6aS,9R)-7,9-dimethyl-4-prop-2-enyl-6a,8-dihydro-6H-indolo[4,3-fg]quinolin-9-ol |
| SMILES | C=CCn1cc2c3c(cccc31)C1=C[C@@](C)(O)CN(C)[C@H]1C2 |
| InChI | InChI=1S/C19H22N2O/c1-4-8-21-11-13-9-17-15(10-19(2,22)12-20(17)3)14-6-5-7-16(21)18(13)14/h4-7,10-11,17,22H,1,8-9,12H2,2-3H3/t17-,19+/m0/s1 |
| InChIKey | IBJYJJLRLYIGFB-PKOBYXMFSA-N |
| XLogP | 2.83 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|