C23H24N2 — CID 22814540
(6aR,9R)-4-benzyl-7,9-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline (PubChem CID 22814540) has the molecular formula C23H24N2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (6aR,9R)-4-benzyl-7,9-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline.
| Compound Name | (6aR,9R)-4-benzyl-7,9-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 22814540 |
| Molecular Formula | C23H24N2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (6aR,9R)-4-benzyl-7,9-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline |
| SMILES | C[C@@H]1C=C2c3cccc4c3c(cn4Cc3ccccc3)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C23H24N2/c1-16-11-20-19-9-6-10-21-23(19)18(12-22(20)24(2)13-16)15-25(21)14-17-7-4-3-5-8-17/h3-11,15-16,22H,12-14H2,1-2H3/t16-,22-/m1/s1 |
| InChIKey | OCELRSSLYNONBV-OPAMFIHVSA-N |
| XLogP | 4.58 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|