C18H22N2O — CID 139697319
(6aS,9R)-4-ethyl-7,9-dimethyl-6a,8-dihydro-6H-indolo[4,3-fg]quinolin-9-ol (PubChem CID 139697319) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is (6aS,9R)-4-ethyl-7,9-dimethyl-6a,8-dihydro-6H-indolo[4,3-fg]quinolin-9-ol.
| Compound Name | (6aS,9R)-4-ethyl-7,9-dimethyl-6a,8-dihydro-6H-indolo[4,3-fg]quinolin-9-ol |
|---|---|
| PubChem CID | 139697319 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (6aS,9R)-4-ethyl-7,9-dimethyl-6a,8-dihydro-6H-indolo[4,3-fg]quinolin-9-ol |
| SMILES | CCn1cc2c3c(cccc31)C1=C[C@@](C)(O)CN(C)[C@H]1C2 |
| InChI | InChI=1S/C18H22N2O/c1-4-20-10-12-8-16-14(9-18(2,21)11-19(16)3)13-6-5-7-15(20)17(12)13/h5-7,9-10,16,21H,4,8,11H2,1-3H3/t16-,18+/m0/s1 |
| InChIKey | AQPFUACWDMOPLH-FUHWJXTLSA-N |
| XLogP | 2.67 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|