C21H24F3N3O2 — CID 90247733
(6aR,9R)-N-[(2S)-1-hydroxybutan-2-yl]-7-methyl-4-(trifluoromethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 90247733) has the molecular formula C21H24F3N3O2 and a molecular weight of 407.44 g/mol. Its IUPAC name is (6aR,9R)-N-[(2S)-1-hydroxybutan-2-yl]-7-methyl-4-(trifluoromethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-N-[(2S)-1-hydroxybutan-2-yl]-7-methyl-4-(trifluoromethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 90247733 |
| Molecular Formula | C21H24F3N3O2 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | (6aR,9R)-N-[(2S)-1-hydroxybutan-2-yl]-7-methyl-4-(trifluoromethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CC[C@@H](CO)NC(=O)[C@@H]1C=C2c3cccc4c3c(cn4C(F)(F)F)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C21H24F3N3O2/c1-3-14(11-28)25-20(29)13-7-16-15-5-4-6-17-19(15)12(8-18(16)26(2)9-13)10-27(17)21(22,23)24/h4-7,10,13-14,18,28H,3,8-9,11H2,1-2H3,(H,25,29)/t13-,14+,18-/m1/s1 |
| InChIKey | JHTDDYCBIJFFKL-QWQRMKEZSA-N |
| XLogP | 2.87 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |