C21H26FN3O — CID 166091912
(6aR,9R)-5-fluoro-7-methyl-N-pentan-3-yl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 166091912) has the molecular formula C21H26FN3O and a molecular weight of 355.46 g/mol. Its IUPAC name is (6aR,9R)-5-fluoro-7-methyl-N-pentan-3-yl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-5-fluoro-7-methyl-N-pentan-3-yl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 166091912 |
| Molecular Formula | C21H26FN3O |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (6aR,9R)-5-fluoro-7-methyl-N-pentan-3-yl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CCC(CC)NC(=O)[C@@H]1C=C2c3cccc4[nH]c(F)c(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C21H26FN3O/c1-4-13(5-2)23-21(26)12-9-15-14-7-6-8-17-19(14)16(20(22)24-17)10-18(15)25(3)11-12/h6-9,12-13,18,24H,4-5,10-11H2,1-3H3,(H,23,26)/t12-,18-/m1/s1 |
| InChIKey | MSIVJCCDLWPMMM-KZULUSFZSA-N |
| XLogP | 3.48 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |