C20H24BN3O — CID 172577975
CID 172577975 (PubChem CID 172577975) has the molecular formula C20H24BN3O and a molecular weight of 333.24 g/mol.
| Compound Name | CID 172577975 |
|---|---|
| PubChem CID | 172577975 |
| Molecular Formula | C20H24BN3O |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | — |
| SMILES | [B]c1[nH]c2cccc3c2c1CC1C3=CC(C(=O)NC(C)CC)CN1C |
| InChI | InChI=1S/C20H24BN3O/c1-4-11(2)22-20(25)12-8-14-13-6-5-7-16-18(13)15(19(21)23-16)9-17(14)24(3)10-12/h5-8,11-12,17,23H,4,9-10H2,1-3H3,(H,22,25) |
| InChIKey | KUPRQHSRINIAOY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|