C23H31N3O — CID 166091828
(6aR,9R)-N-butan-2-yl-7-butyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 166091828) has the molecular formula C23H31N3O and a molecular weight of 365.52 g/mol. Its IUPAC name is (6aR,9R)-N-butan-2-yl-7-butyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-N-butan-2-yl-7-butyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 166091828 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | (6aR,9R)-N-butan-2-yl-7-butyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CCCCN1C[C@H](C(=O)NC(C)CC)C=C2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C23H31N3O/c1-4-6-10-26-14-17(23(27)25-15(3)5-2)11-19-18-8-7-9-20-22(18)16(13-24-20)12-21(19)26/h7-9,11,13,15,17,21,24H,4-6,10,12,14H2,1-3H3,(H,25,27)/t15?,17-,21-/m1/s1 |
| InChIKey | LKBBUAYNRZZZOD-NZAAYYPMSA-N |
| XLogP | 4.12 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |