C27H31N3O2 — CID 166091745
(6aR,9R)-N-[(2R)-butan-2-yl]-7-[(2-methoxyphenyl)methyl]-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 166091745) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is (6aR,9R)-N-[(2R)-butan-2-yl]-7-[(2-methoxyphenyl)methyl]-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-N-[(2R)-butan-2-yl]-7-[(2-methoxyphenyl)methyl]-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 166091745 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | (6aR,9R)-N-[(2R)-butan-2-yl]-7-[(2-methoxyphenyl)methyl]-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CC[C@@H](C)NC(=O)[C@@H]1C=C2c3cccc4[nH]cc(c34)C[C@H]2N(Cc2ccccc2OC)C1 |
| InChI | InChI=1S/C27H31N3O2/c1-4-17(2)29-27(31)20-12-22-21-9-7-10-23-26(21)19(14-28-23)13-24(22)30(16-20)15-18-8-5-6-11-25(18)32-3/h5-12,14,17,20,24,28H,4,13,15-16H2,1-3H3,(H,29,31)/t17-,20-,24-/m1/s1 |
| InChIKey | YNRPKZICOAUNNT-WSCWJOSJSA-N |
| XLogP | 4.53 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |