C19H18F5N3O — CID 144653669
(6aR)-4-(difluoromethyl)-N,7-dimethyl-5-(trifluoromethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 144653669) has the molecular formula C19H18F5N3O and a molecular weight of 399.36 g/mol. Its IUPAC name is (6aR)-4-(difluoromethyl)-N,7-dimethyl-5-(trifluoromethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR)-4-(difluoromethyl)-N,7-dimethyl-5-(trifluoromethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 144653669 |
| Molecular Formula | C19H18F5N3O |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (6aR)-4-(difluoromethyl)-N,7-dimethyl-5-(trifluoromethyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CNC(=O)C1C=C2c3cccc4c3c(c(C(F)(F)F)n4C(F)F)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C19H18F5N3O/c1-25-17(28)9-6-11-10-4-3-5-13-15(10)12(7-14(11)26(2)8-9)16(19(22,23)24)27(13)18(20)21/h3-6,9,14,18H,7-8H2,1-2H3,(H,25,28)/t9?,14-/m1/s1 |
| InChIKey | ITHDFLLURMREBZ-IWSPRGBSSA-N |
| XLogP | 3.67 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |