C22H28N4O2 — CID 129276760
N'-ethyl-N'-(hydroxymethyl)-16-methyl-6,16-diazapentacyclo[9.7.1.02,6.07,19.012,17]nonadeca-1,7,9,11(19),12-pentaene-14-carbohydrazide (PubChem CID 129276760) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N'-ethyl-N'-(hydroxymethyl)-16-methyl-6,16-diazapentacyclo[9.7.1.02,6.07,19.012,17]nonadeca-1,7,9,11(19),12-pentaene-14-carbohydrazide.
| Compound Name | N'-ethyl-N'-(hydroxymethyl)-16-methyl-6,16-diazapentacyclo[9.7.1.02,6.07,19.012,17]nonadeca-1,7,9,11(19),12-pentaene-14-carbohydrazide |
|---|---|
| PubChem CID | 129276760 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | N'-ethyl-N'-(hydroxymethyl)-16-methyl-6,16-diazapentacyclo[9.7.1.02,6.07,19.012,17]nonadeca-1,7,9,11(19),12-pentaene-14-carbohydrazide |
| SMILES | CCN(CO)NC(=O)C1C=C2c3cccc4c3c(c3n4CCC3)CC2N(C)C1 |
| InChI | InChI=1S/C22H28N4O2/c1-3-25(13-27)23-22(28)14-10-16-15-6-4-7-19-21(15)17(11-20(16)24(2)12-14)18-8-5-9-26(18)19/h4,6-7,10,14,20,27H,3,5,8-9,11-13H2,1-2H3,(H,23,28) |
| InChIKey | JURONPCYDMCZCC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|