C18H18FIN2O — CID 139697318
(6aR,9S)-4-(1-fluoro-2-iodoethenyl)-7,9-dimethyl-6a,8-dihydro-6H-indolo[4,3-fg]quinolin-9-ol (PubChem CID 139697318) has the molecular formula C18H18FIN2O and a molecular weight of 424.26 g/mol. Its IUPAC name is (6aR,9S)-4-(1-fluoro-2-iodoethenyl)-7,9-dimethyl-6a,8-dihydro-6H-indolo[4,3-fg]quinolin-9-ol.
| Compound Name | (6aR,9S)-4-(1-fluoro-2-iodoethenyl)-7,9-dimethyl-6a,8-dihydro-6H-indolo[4,3-fg]quinolin-9-ol |
|---|---|
| PubChem CID | 139697318 |
| Molecular Formula | C18H18FIN2O |
| Molecular Weight | 424.26 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | (6aR,9S)-4-(1-fluoro-2-iodoethenyl)-7,9-dimethyl-6a,8-dihydro-6H-indolo[4,3-fg]quinolin-9-ol |
| SMILES | CN1C[C@@](C)(O)C=C2c3cccc4c3c(cn4C(F)=CI)C[C@H]21 |
| InChI | InChI=1S/C18H18FIN2O/c1-18(23)7-13-12-4-3-5-14-17(12)11(6-15(13)21(2)10-18)9-22(14)16(19)8-20/h3-5,7-9,15,23H,6,10H2,1-2H3/t15-,18+/m1/s1 |
| InChIKey | GBLLHULIVHWFML-QAPCUYQASA-N |
| XLogP | 3.81 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|