C34H38N4 — CID 70116896
(6aR,9S)-9-[(4-benzhydrylpiperazin-1-yl)methyl]-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline (PubChem CID 70116896) has the molecular formula C34H38N4 and a molecular weight of 502.71 g/mol. Its IUPAC name is (6aR,9S)-9-[(4-benzhydrylpiperazin-1-yl)methyl]-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline.
| Compound Name | (6aR,9S)-9-[(4-benzhydrylpiperazin-1-yl)methyl]-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 70116896 |
| Molecular Formula | C34H38N4 |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | (6aR,9S)-9-[(4-benzhydrylpiperazin-1-yl)methyl]-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline |
| SMILES | CN1C[C@H](CN2CCN(C(c3ccccc3)c3ccccc3)CC2)C=C2c3cccc4c3c(cn4C)C[C@H]21 |
| InChI | InChI=1S/C34H38N4/c1-35-22-25(20-30-29-14-9-15-31-33(29)28(21-32(30)35)24-36(31)2)23-37-16-18-38(19-17-37)34(26-10-5-3-6-11-26)27-12-7-4-8-13-27/h3-15,20,24-25,32,34H,16-19,21-23H2,1-2H3/t25-,32-/m1/s1 |
| InChIKey | JOCPUFWCYVVITJ-NLGDKJDOSA-N |
| XLogP | 5.46 |
| TPSA | 14.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|