C25H33N5O2 — CID 42630755
(6aR,9R)-N-[2-(dimethylamino)ethylcarbamoyl]-4-ethenyl-N-ethyl-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 42630755) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is (6aR,9R)-N-[2-(dimethylamino)ethylcarbamoyl]-4-ethenyl-N-ethyl-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-N-[2-(dimethylamino)ethylcarbamoyl]-4-ethenyl-N-ethyl-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 42630755 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | (6aR,9R)-N-[2-(dimethylamino)ethylcarbamoyl]-4-ethenyl-N-ethyl-7-methyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | C=Cn1cc2c3c(cccc31)C1=C[C@@H](C(=O)N(CC)C(=O)NCCN(C)C)CN(C)[C@@H]1C2 |
| InChI | InChI=1S/C25H33N5O2/c1-6-29-16-17-14-22-20(19-9-8-10-21(29)23(17)19)13-18(15-28(22)5)24(31)30(7-2)25(32)26-11-12-27(3)4/h6,8-10,13,16,18,22H,1,7,11-12,14-15H2,2-5H3,(H,26,32)/t18-,22-/m1/s1 |
| InChIKey | IOURQUSVACLWPN-XMSQKQJNSA-N |
| XLogP | 2.73 |
| TPSA | 60.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |