C27H28N4O2 — CID 163525313
(6aR,9R)-4-methyl-N-phenyl-9-(pyrrolidine-1-carbonyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-7-carboxamide (PubChem CID 163525313) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is (6aR,9R)-4-methyl-N-phenyl-9-(pyrrolidine-1-carbonyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-7-carboxamide.
| Compound Name | (6aR,9R)-4-methyl-N-phenyl-9-(pyrrolidine-1-carbonyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 163525313 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (6aR,9R)-4-methyl-N-phenyl-9-(pyrrolidine-1-carbonyl)-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-7-carboxamide |
| SMILES | Cn1cc2c3c(cccc31)C1=C[C@@H](C(=O)N3CCCC3)CN(C(=O)Nc3ccccc3)[C@@H]1C2 |
| InChI | InChI=1S/C27H28N4O2/c1-29-16-18-15-24-22(21-10-7-11-23(29)25(18)21)14-19(26(32)30-12-5-6-13-30)17-31(24)27(33)28-20-8-3-2-4-9-20/h2-4,7-11,14,16,19,24H,5-6,12-13,15,17H2,1H3,(H,28,33)/t19-,24-/m1/s1 |
| InChIKey | DOGIJMKPAIOXRB-NTKDMRAZSA-N |
| XLogP | 4.27 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|