C19H21N3O2 — CID 141156288
[(6aR,9R)-4-hydroxy-6a,7,8,9-tetrahydro-6H-indolo[4,3-fg]quinolin-9-yl]-pyrrolidin-1-ylmethanone (PubChem CID 141156288) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is [(6aR,9R)-4-hydroxy-6a,7,8,9-tetrahydro-6H-indolo[4,3-fg]quinolin-9-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(6aR,9R)-4-hydroxy-6a,7,8,9-tetrahydro-6H-indolo[4,3-fg]quinolin-9-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 141156288 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | [(6aR,9R)-4-hydroxy-6a,7,8,9-tetrahydro-6H-indolo[4,3-fg]quinolin-9-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C([C@@H]1C=C2c3cccc4c3c(cn4O)C[C@H]2NC1)N1CCCC1 |
| InChI | InChI=1S/C19H21N3O2/c23-19(21-6-1-2-7-21)12-8-15-14-4-3-5-17-18(14)13(11-22(17)24)9-16(15)20-10-12/h3-5,8,11-12,16,20,24H,1-2,6-7,9-10H2/t12-,16-/m1/s1 |
| InChIKey | PZGZOHFPUQXRHE-MLGOLLRUSA-N |
| XLogP | 2.03 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|