C23H32N4O2 — CID 167428238
(6aR,9R)-N-[3-(dimethylamino)propoxy]-N-propan-2-yl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 167428238) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is (6aR,9R)-N-[3-(dimethylamino)propoxy]-N-propan-2-yl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-N-[3-(dimethylamino)propoxy]-N-propan-2-yl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 167428238 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (6aR,9R)-N-[3-(dimethylamino)propoxy]-N-propan-2-yl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CC(C)N(OCCCN(C)C)C(=O)[C@@H]1C=C2c3cccc4[nH]cc(c34)C[C@H]2NC1 |
| InChI | InChI=1S/C23H32N4O2/c1-15(2)27(29-10-6-9-26(3)4)23(28)17-11-19-18-7-5-8-20-22(18)16(13-24-20)12-21(19)25-14-17/h5,7-8,11,13,15,17,21,24-25H,6,9-10,12,14H2,1-4H3/t17-,21-/m1/s1 |
| InChIKey | RFKBDMGQHWWMBV-DYESRHJHSA-N |
| XLogP | 2.82 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|