C23H32ClN3OSi — CID 174960263
CID 174960263 (PubChem CID 174960263) has the molecular formula C23H32ClN3OSi and a molecular weight of 430.07 g/mol.
| Compound Name | CID 174960263 |
|---|---|
| PubChem CID | 174960263 |
| Molecular Formula | C23H32ClN3OSi |
| Molecular Weight | 430.07 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | — |
| SMILES | CC(C)[Si]Cl.CCN(CC)C(=O)[C@@H]1C=C2c3cccc4[nH]cc(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C20H25N3O.C3H7ClSi/c1-4-23(5-2)20(24)14-9-16-15-7-6-8-17-19(15)13(11-21-17)10-18(16)22(3)12-14;1-3(2)5-4/h6-9,11,14,18,21H,4-5,10,12H2,1-3H3;3H,1-2H3/t14-,18-;/m1./s1 |
| InChIKey | NJDIPUNLYJJCRH-KEZWHQCISA-N |
| XLogP | 4.58 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.07 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|