C27H41N3O2S4 — CID 174862395
(6aR,9R)-N,N-diethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;carbonodithioic S,S-acid;2-(propan-2-yldisulfanyl)propane (PubChem CID 174862395) has the molecular formula C27H41N3O2S4 and a molecular weight of 567.91 g/mol. Its IUPAC name is (6aR,9R)-N,N-diethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;carbonodithioic S,S-acid;2-(propan-2-yldisulfanyl)propane.
| Compound Name | (6aR,9R)-N,N-diethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;carbonodithioic S,S-acid;2-(propan-2-yldisulfanyl)propane |
|---|---|
| PubChem CID | 174862395 |
| Molecular Formula | C27H41N3O2S4 |
| Molecular Weight | 567.91 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | (6aR,9R)-N,N-diethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;carbonodithioic S,S-acid;2-(propan-2-yldisulfanyl)propane |
| SMILES | CC(C)SSC(C)C.CCN(CC)C(=O)[C@@H]1C=C2c3cccc4[nH]cc(c34)C[C@H]2N(C)C1.O=C(S)S |
| InChI | InChI=1S/C20H25N3O.C6H14S2.CH2OS2/c1-4-23(5-2)20(24)14-9-16-15-7-6-8-17-19(15)13(11-21-17)10-18(16)22(3)12-14;1-5(2)7-8-6(3)4;2-1(3)4/h6-9,11,14,18,21H,4-5,10,12H2,1-3H3;5-6H,1-4H3;(H2,2,3,4)/t14-,18-;;/m1../s1 |
| InChIKey | HHZVJGWBUJLXBC-ROIBWGDASA-N |
| XLogP | 7.06 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.91 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|