C15H16N2O — CID 123663983
4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-9-ylmethanol (PubChem CID 123663983) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-9-ylmethanol.
| Compound Name | 4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-9-ylmethanol |
|---|---|
| PubChem CID | 123663983 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-9-ylmethanol |
| SMILES | OCC1C=C2c3cccc4[nH]cc(c34)CC2NC1 |
| InChI | InChI=1S/C15H16N2O/c18-8-9-4-12-11-2-1-3-13-15(11)10(7-17-13)5-14(12)16-6-9/h1-4,7,9,14,16-18H,5-6,8H2 |
| InChIKey | IECDUHOPXGMRHI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |