C22H28N2O6 — CID 10645557
(2S,3R,4S,5R,6R)-2-[[(6aR)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 10645557) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[[(6aR)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-2-[[(6aR)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10645557 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[[(6aR)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CN1CC(CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)C=C2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C22H28N2O6/c1-24-8-11(10-29-22-21(28)20(27)19(26)17(9-25)30-22)5-14-13-3-2-4-15-18(13)12(7-23-15)6-16(14)24/h2-5,7,11,16-17,19-23,25-28H,6,8-10H2,1H3/t11?,16-,17-,19+,20+,21-,22+/m1/s1 |
| InChIKey | PNWPXMYYLYEFLR-ODNKZQDFSA-N |
| XLogP | -0.15 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |