C18H23N3OS — CID 174364920
(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;methylsulfanylmethane (PubChem CID 174364920) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is (6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;methylsulfanylmethane.
| Compound Name | (6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;methylsulfanylmethane |
|---|---|
| PubChem CID | 174364920 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;methylsulfanylmethane |
| SMILES | CN1C[C@H](C(N)=O)C=C2c3cccc4[nH]cc(c34)C[C@H]21.CSC |
| InChI | InChI=1S/C16H17N3O.C2H6S/c1-19-8-10(16(17)20)5-12-11-3-2-4-13-15(11)9(7-18-13)6-14(12)19;1-3-2/h2-5,7,10,14,18H,6,8H2,1H3,(H2,17,20);1-2H3/t10-,14-;/m1./s1 |
| InChIKey | KZUAESZRQMFUFJ-BWTUWSSMSA-N |
| XLogP | 2.50 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |