C17H20N4O — CID 70390159
[(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methylurea (PubChem CID 70390159) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is [(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methylurea.
| Compound Name | [(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methylurea |
|---|---|
| PubChem CID | 70390159 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | [(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methylurea |
| SMILES | CN1C[C@@H](CNC(N)=O)C=C2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C17H20N4O/c1-21-9-10(7-20-17(18)22)5-13-12-3-2-4-14-16(12)11(8-19-14)6-15(13)21/h2-5,8,10,15,19H,6-7,9H2,1H3,(H3,18,20,22)/t10-,15-/m1/s1 |
| InChIKey | NCNRJZCHSQZVCO-MEBBXXQBSA-N |
| XLogP | 1.71 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |