C18H22N4O — CID 118989318
1-[(6aR,9S)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-3-ethylurea (PubChem CID 118989318) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 1-[(6aR,9S)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-3-ethylurea.
| Compound Name | 1-[(6aR,9S)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-3-ethylurea |
|---|---|
| PubChem CID | 118989318 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1-[(6aR,9S)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-3-ethylurea |
| SMILES | CCNC(=O)N[C@H]1C=C2c3cccc4[nH]cc(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C18H22N4O/c1-3-19-18(23)21-12-8-14-13-5-4-6-15-17(13)11(9-20-15)7-16(14)22(2)10-12/h4-6,8-9,12,16,20H,3,7,10H2,1-2H3,(H2,19,21,23)/t12-,16+/m0/s1 |
| InChIKey | CBXQVLYIPOWHGA-BLLLJJGKSA-N |
| XLogP | 2.11 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |