C16H17IN2 — CID 166091886
(6aR)-9-(iodomethyl)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 166091886) has the molecular formula C16H17IN2 and a molecular weight of 364.23 g/mol. Its IUPAC name is (6aR)-9-(iodomethyl)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | (6aR)-9-(iodomethyl)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 166091886 |
| Molecular Formula | C16H17IN2 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | (6aR)-9-(iodomethyl)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | CN1CC(CI)C=C2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C16H17IN2/c1-19-9-10(7-17)5-13-12-3-2-4-14-16(12)11(8-18-14)6-15(13)19/h2-5,8,10,15,18H,6-7,9H2,1H3/t10?,15-/m1/s1 |
| InChIKey | UMDPNFVXELPKFH-GENIYJEYSA-N |
| XLogP | 3.47 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|