C16H19N2O+ — CID 7059542
[(6aR,9S)-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium-9-yl]methanol (PubChem CID 7059542) has the molecular formula C16H19N2O+ and a molecular weight of 255.34 g/mol. Its IUPAC name is [(6aR,9S)-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium-9-yl]methanol.
| Compound Name | [(6aR,9S)-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium-9-yl]methanol |
|---|---|
| PubChem CID | 7059542 |
| Molecular Formula | C16H19N2O+ |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | [(6aR,9S)-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium-9-yl]methanol |
| SMILES | C[NH+]1C[C@@H](CO)C=C2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C16H18N2O/c1-18-8-10(9-19)5-13-12-3-2-4-14-16(12)11(7-17-14)6-15(13)18/h2-5,7,10,15,17,19H,6,8-9H2,1H3/p+1/t10-,15+/m0/s1 |
| InChIKey | BIXJFIJYBLJTMK-ZUZCIYMTSA-O |
| XLogP | 0.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |