C22H32N5O3S+ — CID 168771409
N-[2-[2-[(6aR,9R)-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium-9-carbonyl]-2-propan-2-ylhydrazinyl]ethyl]methanesulfonamide (PubChem CID 168771409) has the molecular formula C22H32N5O3S+ and a molecular weight of 446.60 g/mol. Its IUPAC name is N-[2-[2-[(6aR,9R)-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium-9-carbonyl]-2-propan-2-ylhydrazinyl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[2-[(6aR,9R)-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium-9-carbonyl]-2-propan-2-ylhydrazinyl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 168771409 |
| Molecular Formula | C22H32N5O3S+ |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N-[2-[2-[(6aR,9R)-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium-9-carbonyl]-2-propan-2-ylhydrazinyl]ethyl]methanesulfonamide |
| SMILES | CC(C)N(NCCNS(C)(=O)=O)C(=O)[C@@H]1C=C2c3cccc4[nH]cc(c34)C[C@H]2[NH+](C)C1 |
| InChI | InChI=1S/C22H31N5O3S/c1-14(2)27(24-8-9-25-31(4,29)30)22(28)16-10-18-17-6-5-7-19-21(17)15(12-23-19)11-20(18)26(3)13-16/h5-7,10,12,14,16,20,23-25H,8-9,11,13H2,1-4H3/p+1/t16-,20-/m1/s1 |
| InChIKey | CMXHSYLGDZTVJA-OXQOHEQNSA-O |
| XLogP | -0.09 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|