C20H25FN3O+ — CID 164763866
(6aR,9R)-N,N-diethyl-1-fluoro-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium-9-carboxamide (PubChem CID 164763866) has the molecular formula C20H25FN3O+ and a molecular weight of 342.44 g/mol. Its IUPAC name is (6aR,9R)-N,N-diethyl-1-fluoro-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium-9-carboxamide.
| Compound Name | (6aR,9R)-N,N-diethyl-1-fluoro-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium-9-carboxamide |
|---|---|
| PubChem CID | 164763866 |
| Molecular Formula | C20H25FN3O+ |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (6aR,9R)-N,N-diethyl-1-fluoro-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium-9-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1C=C2c3c(F)ccc4[nH]cc(c34)C[C@H]2[NH+](C)C1 |
| InChI | InChI=1S/C20H24FN3O/c1-4-24(5-2)20(25)13-8-14-17(23(3)11-13)9-12-10-22-16-7-6-15(21)19(14)18(12)16/h6-8,10,13,17,22H,4-5,9,11H2,1-3H3/p+1/t13-,17-/m1/s1 |
| InChIKey | XTFFBRLPBZSLEL-CXAGYDPISA-O |
| XLogP | 1.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |