C20H23F3N3O+ — CID 164763833
(6aS,9R)-N,N-diethyl-1,2,5-trifluoro-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium-9-carboxamide (PubChem CID 164763833) has the molecular formula C20H23F3N3O+ and a molecular weight of 378.42 g/mol. Its IUPAC name is (6aS,9R)-N,N-diethyl-1,2,5-trifluoro-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium-9-carboxamide.
| Compound Name | (6aS,9R)-N,N-diethyl-1,2,5-trifluoro-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium-9-carboxamide |
|---|---|
| PubChem CID | 164763833 |
| Molecular Formula | C20H23F3N3O+ |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (6aS,9R)-N,N-diethyl-1,2,5-trifluoro-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium-9-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1C=C2c3c(F)c(F)cc4[nH]c(F)c(c34)C[C@@H]2[NH+](C)C1 |
| InChI | InChI=1S/C20H22F3N3O/c1-4-26(5-2)20(27)10-6-11-15(25(3)9-10)7-12-16-14(24-19(12)23)8-13(21)18(22)17(11)16/h6,8,10,15,24H,4-5,7,9H2,1-3H3/p+1/t10-,15+/m1/s1 |
| InChIKey | FQGPHZLEGKTNPC-BMIGLBTASA-O |
| XLogP | 1.91 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |