C28H40N3O3+ — CID 172622460
tert-butyl 4-[(6aR,9R)-9-(diethylcarbamoyl)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-7-ium-7-yl]butanoate (PubChem CID 172622460) has the molecular formula C28H40N3O3+ and a molecular weight of 466.65 g/mol. Its IUPAC name is tert-butyl 4-[(6aR,9R)-9-(diethylcarbamoyl)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-7-ium-7-yl]butanoate.
| Compound Name | tert-butyl 4-[(6aR,9R)-9-(diethylcarbamoyl)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-7-ium-7-yl]butanoate |
|---|---|
| PubChem CID | 172622460 |
| Molecular Formula | C28H40N3O3+ |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | tert-butyl 4-[(6aR,9R)-9-(diethylcarbamoyl)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-7-ium-7-yl]butanoate |
| SMILES | CCN(CC)C(=O)[C@@H]1C=C2c3cccc4[nH]cc(c34)C[C@H]2[N+](C)(CCCC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C28H40N3O3/c1-7-30(8-2)27(33)20-15-22-21-11-9-12-23-26(21)19(17-29-23)16-24(22)31(6,18-20)14-10-13-25(32)34-28(3,4)5/h9,11-12,15,17,20,24,29H,7-8,10,13-14,16,18H2,1-6H3/q+1/t20-,24-,31?/m1/s1 |
| InChIKey | OQUQXCBEHBWKEG-JADHRHQCSA-N |
| XLogP | 4.54 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|