C21H27N3O2 — CID 170213107
(6aR,9R)-N,N-diethyl-2-methoxy-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 170213107) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is (6aR,9R)-N,N-diethyl-2-methoxy-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-N,N-diethyl-2-methoxy-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 170213107 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | (6aR,9R)-N,N-diethyl-2-methoxy-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1C=C2c3cc(OC)cc4[nH]cc(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C21H27N3O2/c1-5-24(6-2)21(25)14-7-16-17-9-15(26-4)10-18-20(17)13(11-22-18)8-19(16)23(3)12-14/h7,9-11,14,19,22H,5-6,8,12H2,1-4H3/t14-,19-/m1/s1 |
| InChIKey | NFQMBWPVBDJETC-AUUYWEPGSA-N |
| XLogP | 2.91 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |