C21H24F3N3O — CID 165360217
(6aR,9R)-N,N-diethyl-7-methyl-2-(trifluoromethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 165360217) has the molecular formula C21H24F3N3O and a molecular weight of 391.44 g/mol. Its IUPAC name is (6aR,9R)-N,N-diethyl-7-methyl-2-(trifluoromethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-N,N-diethyl-7-methyl-2-(trifluoromethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 165360217 |
| Molecular Formula | C21H24F3N3O |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (6aR,9R)-N,N-diethyl-7-methyl-2-(trifluoromethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1C=C2c3cc(C(F)(F)F)cc4[nH]cc(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C21H24F3N3O/c1-4-27(5-2)20(28)13-6-15-16-8-14(21(22,23)24)9-17-19(16)12(10-25-17)7-18(15)26(3)11-13/h6,8-10,13,18,25H,4-5,7,11H2,1-3H3/t13-,18-/m1/s1 |
| InChIKey | PIODRDXFLKSEFU-FZKQIMNGSA-N |
| XLogP | 3.92 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |