C13H14F3NO — CID 63954344
N-(cyclopropylmethyl)-N-ethyl-3,4,5-trifluorobenzamide (PubChem CID 63954344) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-ethyl-3,4,5-trifluorobenzamide.
| Compound Name | N-(cyclopropylmethyl)-N-ethyl-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 63954344 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-(cyclopropylmethyl)-N-ethyl-3,4,5-trifluorobenzamide |
| SMILES | CCN(CC1CC1)C(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H14F3NO/c1-2-17(7-8-3-4-8)13(18)9-5-10(14)12(16)11(15)6-9/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | UTVNOXOSQJKHQE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|