C16H23ClF2N2O — CID 172648900
N,N-diethyl-3,4-difluoro-5-piperidin-4-ylbenzamide;hydrochloride (PubChem CID 172648900) has the molecular formula C16H23ClF2N2O and a molecular weight of 332.82 g/mol. Its IUPAC name is N,N-diethyl-3,4-difluoro-5-piperidin-4-ylbenzamide;hydrochloride.
| Compound Name | N,N-diethyl-3,4-difluoro-5-piperidin-4-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 172648900 |
| Molecular Formula | C16H23ClF2N2O |
| Molecular Weight | 332.82 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N,N-diethyl-3,4-difluoro-5-piperidin-4-ylbenzamide;hydrochloride |
| SMILES | CCN(CC)C(=O)c1cc(F)c(F)c(C2CCNCC2)c1.Cl |
| InChI | InChI=1S/C16H22F2N2O.ClH/c1-3-20(4-2)16(21)12-9-13(15(18)14(17)10-12)11-5-7-19-8-6-11;/h9-11,19H,3-8H2,1-2H3;1H |
| InChIKey | CQTKOFVHFAADBO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.82 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |