C17H22F2N2O — CID 172648907
(3,4-difluoro-5-piperidin-4-ylphenyl)-piperidin-1-ylmethanone (PubChem CID 172648907) has the molecular formula C17H22F2N2O and a molecular weight of 308.37 g/mol. Its IUPAC name is (3,4-difluoro-5-piperidin-4-ylphenyl)-piperidin-1-ylmethanone.
| Compound Name | (3,4-difluoro-5-piperidin-4-ylphenyl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 172648907 |
| Molecular Formula | C17H22F2N2O |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | (3,4-difluoro-5-piperidin-4-ylphenyl)-piperidin-1-ylmethanone |
| SMILES | O=C(c1cc(F)c(F)c(C2CCNCC2)c1)N1CCCCC1 |
| InChI | InChI=1S/C17H22F2N2O/c18-15-11-13(17(22)21-8-2-1-3-9-21)10-14(16(15)19)12-4-6-20-7-5-12/h10-12,20H,1-9H2 |
| InChIKey | NRTDVPOPNFATPK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |