C12H10F3NO3 — CID 55160200
1-(3,4,5-trifluorobenzoyl)pyrrolidine-3-carboxylic acid (PubChem CID 55160200) has the molecular formula C12H10F3NO3 and a molecular weight of 273.21 g/mol. Its IUPAC name is 1-(3,4,5-trifluorobenzoyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(3,4,5-trifluorobenzoyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 55160200 |
| Molecular Formula | C12H10F3NO3 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 1-(3,4,5-trifluorobenzoyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)c2cc(F)c(F)c(F)c2)C1 |
| InChI | InChI=1S/C12H10F3NO3/c13-8-3-7(4-9(14)10(8)15)11(17)16-2-1-6(5-16)12(18)19/h3-4,6H,1-2,5H2,(H,18,19) |
| InChIKey | UCBHZTVUHGCQIV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|