C19H16F3NO3 — CID 119349636
1-[4-(3,4,5-trifluorophenyl)benzoyl]piperidine-4-carboxylic acid (PubChem CID 119349636) has the molecular formula C19H16F3NO3 and a molecular weight of 363.34 g/mol. Its IUPAC name is 1-[4-(3,4,5-trifluorophenyl)benzoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-(3,4,5-trifluorophenyl)benzoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119349636 |
| Molecular Formula | C19H16F3NO3 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 1-[4-(3,4,5-trifluorophenyl)benzoyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)c2ccc(-c3cc(F)c(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C19H16F3NO3/c20-15-9-14(10-16(21)17(15)22)11-1-3-12(4-2-11)18(24)23-7-5-13(6-8-23)19(25)26/h1-4,9-10,13H,5-8H2,(H,25,26) |
| InChIKey | NGVXEYJYQICGNK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|