C17H21N2+ — CID 172577988
(6aR)-9-ethyl-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium (PubChem CID 172577988) has the molecular formula C17H21N2+ and a molecular weight of 253.37 g/mol. Its IUPAC name is (6aR)-9-ethyl-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium.
| Compound Name | (6aR)-9-ethyl-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium |
|---|---|
| PubChem CID | 172577988 |
| Molecular Formula | C17H21N2+ |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | (6aR)-9-ethyl-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-7-ium |
| SMILES | CCC1C=C2c3cccc4[nH]cc(c34)C[C@H]2[NH+](C)C1 |
| InChI | InChI=1S/C17H20N2/c1-3-11-7-14-13-5-4-6-15-17(13)12(9-18-15)8-16(14)19(2)10-11/h4-7,9,11,16,18H,3,8,10H2,1-2H3/p+1/t11?,16-/m1/s1 |
| InChIKey | QQKGTNZSFFNYHP-WVQRXBFSSA-O |
| XLogP | 2.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |