C16H18N2 — CID 166091851
7-ethyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 166091851) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 7-ethyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | 7-ethyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 166091851 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 7-ethyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | CCN1CCC=C2c3cccc4[nH]cc(c34)CC21 |
| InChI | InChI=1S/C16H18N2/c1-2-18-8-4-6-12-13-5-3-7-14-16(13)11(10-17-14)9-15(12)18/h3,5-7,10,15,17H,2,4,8-9H2,1H3 |
| InChIKey | WVDRURQAGJTXRJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |