C22H30N2O3 — CID 67809446
(6aR,9S)-7,9-bis(2-hydroxybutyl)-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-ol (PubChem CID 67809446) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is (6aR,9S)-7,9-bis(2-hydroxybutyl)-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-ol.
| Compound Name | (6aR,9S)-7,9-bis(2-hydroxybutyl)-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-ol |
|---|---|
| PubChem CID | 67809446 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | (6aR,9S)-7,9-bis(2-hydroxybutyl)-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-ol |
| SMILES | CCC(O)CN1C[C@](O)(CC(O)CC)C=C2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C22H30N2O3/c1-3-15(25)9-22(27)10-18-17-6-5-7-19-21(17)14(11-23-19)8-20(18)24(13-22)12-16(26)4-2/h5-7,10-11,15-16,20,23,25-27H,3-4,8-9,12-13H2,1-2H3/t15?,16?,20-,22+/m1/s1 |
| InChIKey | KSLBPRMPFHMZNI-ZFMWPEAZSA-N |
| XLogP | 2.45 |
| TPSA | 79.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |