C22H27N3O — CID 167171045
[(6aR,9R)-7-propan-2-yl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-pyrrolidin-1-ylmethanone (PubChem CID 167171045) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is [(6aR,9R)-7-propan-2-yl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(6aR,9R)-7-propan-2-yl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 167171045 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | [(6aR,9R)-7-propan-2-yl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CC(C)N1C[C@H](C(=O)N2CCCC2)C=C2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C22H27N3O/c1-14(2)25-13-16(22(26)24-8-3-4-9-24)10-18-17-6-5-7-19-21(17)15(12-23-19)11-20(18)25/h5-7,10,12,14,16,20,23H,3-4,8-9,11,13H2,1-2H3/t16-,20-/m1/s1 |
| InChIKey | GZDAWCAQQDXCKV-OXQOHEQNSA-N |
| XLogP | 3.44 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |