C23H29N3O — CID 166092005
[(6aR,9R)-7-propan-2-yl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-(2,4-dimethylazetidin-1-yl)methanone (PubChem CID 166092005) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is [(6aR,9R)-7-propan-2-yl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-(2,4-dimethylazetidin-1-yl)methanone.
| Compound Name | [(6aR,9R)-7-propan-2-yl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-(2,4-dimethylazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 166092005 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | [(6aR,9R)-7-propan-2-yl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-(2,4-dimethylazetidin-1-yl)methanone |
| SMILES | CC1CC(C)N1C(=O)[C@@H]1C=C2c3cccc4[nH]cc(c34)C[C@H]2N(C(C)C)C1 |
| InChI | InChI=1S/C23H29N3O/c1-13(2)25-12-17(23(27)26-14(3)8-15(26)4)9-19-18-6-5-7-20-22(18)16(11-24-20)10-21(19)25/h5-7,9,11,13-15,17,21,24H,8,10,12H2,1-4H3/t14?,15?,17-,21-/m1/s1 |
| InChIKey | NLAMQLWGAHWMAC-FGLRIPBYSA-N |
| XLogP | 3.83 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |