C16H17BrN2 — CID 10686947
(4R,7R)-10-bromo-4,6-dimethyl-6,11-diazatetracyclo[7.6.1.03,7.012,16]hexadeca-1(16),2,9,12,14-pentaene (PubChem CID 10686947) has the molecular formula C16H17BrN2 and a molecular weight of 317.23 g/mol. Its IUPAC name is (4R,7R)-10-bromo-4,6-dimethyl-6,11-diazatetracyclo[7.6.1.03,7.012,16]hexadeca-1(16),2,9,12,14-pentaene.
| Compound Name | (4R,7R)-10-bromo-4,6-dimethyl-6,11-diazatetracyclo[7.6.1.03,7.012,16]hexadeca-1(16),2,9,12,14-pentaene |
|---|---|
| PubChem CID | 10686947 |
| Molecular Formula | C16H17BrN2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | (4R,7R)-10-bromo-4,6-dimethyl-6,11-diazatetracyclo[7.6.1.03,7.012,16]hexadeca-1(16),2,9,12,14-pentaene |
| SMILES | C[C@H]1CN(C)[C@@H]2Cc3c(Br)[nH]c4cccc(c34)C=C21 |
| InChI | InChI=1S/C16H17BrN2/c1-9-8-19(2)14-7-12-15-10(6-11(9)14)4-3-5-13(15)18-16(12)17/h3-6,9,14,18H,7-8H2,1-2H3/t9-,14+/m0/s1 |
| InChIKey | IXAAPFHNYACQOU-LKFCYVNXSA-N |
| XLogP | 3.82 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |