C19H24Br2N2 — CID 91444329
bromomethane;10-bromo-6-methyl-4-propan-2-yl-6,11-diazatetracyclo[7.6.1.03,7.012,16]hexadeca-1(16),2,9,12,14-pentaene (PubChem CID 91444329) has the molecular formula C19H24Br2N2 and a molecular weight of 440.22 g/mol. Its IUPAC name is bromomethane;10-bromo-6-methyl-4-propan-2-yl-6,11-diazatetracyclo[7.6.1.03,7.012,16]hexadeca-1(16),2,9,12,14-pentaene.
| Compound Name | bromomethane;10-bromo-6-methyl-4-propan-2-yl-6,11-diazatetracyclo[7.6.1.03,7.012,16]hexadeca-1(16),2,9,12,14-pentaene |
|---|---|
| PubChem CID | 91444329 |
| Molecular Formula | C19H24Br2N2 |
| Molecular Weight | 440.22 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | bromomethane;10-bromo-6-methyl-4-propan-2-yl-6,11-diazatetracyclo[7.6.1.03,7.012,16]hexadeca-1(16),2,9,12,14-pentaene |
| SMILES | CBr.CC(C)C1CN(C)C2Cc3c(Br)[nH]c4cccc(c34)C=C12 |
| InChI | InChI=1S/C18H21BrN2.CH3Br/c1-10(2)14-9-21(3)16-8-13-17-11(7-12(14)16)5-4-6-15(17)20-18(13)19;1-2/h4-7,10,14,16,20H,8-9H2,1-3H3;1H3 |
| InChIKey | PLKWZCCGAVSSMS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.22 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|