C18H22N2S — CID 87704117
[(6aS)-6-prop-2-enyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-5-yl]methanethiol (PubChem CID 87704117) has the molecular formula C18H22N2S and a molecular weight of 298.46 g/mol. Its IUPAC name is [(6aS)-6-prop-2-enyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-5-yl]methanethiol.
| Compound Name | [(6aS)-6-prop-2-enyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-5-yl]methanethiol |
|---|---|
| PubChem CID | 87704117 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | [(6aS)-6-prop-2-enyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-5-yl]methanethiol |
| SMILES | C=CCC1c2c(CS)[nH]c3cccc(c23)C2CCCN[C@@H]21 |
| InChI | InChI=1S/C18H22N2S/c1-2-5-13-17-15(10-21)20-14-8-3-6-11(16(14)17)12-7-4-9-19-18(12)13/h2-3,6,8,12-13,18-21H,1,4-5,7,9-10H2/t12?,13?,18-/m0/s1 |
| InChIKey | POQUCWIYHSDFLX-KJBLDROHSA-N |
| XLogP | 4.11 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|