C21H22N2O2S — CID 67753197
(6aS)-6-(benzenesulfonyl)-5-methyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline (PubChem CID 67753197) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is (6aS)-6-(benzenesulfonyl)-5-methyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline.
| Compound Name | (6aS)-6-(benzenesulfonyl)-5-methyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 67753197 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (6aS)-6-(benzenesulfonyl)-5-methyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline |
| SMILES | Cc1[nH]c2cccc3c2c1C(S(=O)(=O)c1ccccc1)[C@H]1NCCCC31 |
| InChI | InChI=1S/C21H22N2O2S/c1-13-18-19-15(9-5-11-17(19)23-13)16-10-6-12-22-20(16)21(18)26(24,25)14-7-3-2-4-8-14/h2-5,7-9,11,16,20-23H,6,10,12H2,1H3/t16?,20-,21?/m0/s1 |
| InChIKey | HHFXZFUKDDEODC-WJAMPBCPSA-N |
| XLogP | 3.84 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |