C12H15NO2 — CID 14151587
(4aS,10bR)-2,3,4,4a,5,10b-hexahydro-1H-chromeno[3,4-b]pyridin-7-ol (PubChem CID 14151587) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (4aS,10bR)-2,3,4,4a,5,10b-hexahydro-1H-chromeno[3,4-b]pyridin-7-ol.
| Compound Name | (4aS,10bR)-2,3,4,4a,5,10b-hexahydro-1H-chromeno[3,4-b]pyridin-7-ol |
|---|---|
| PubChem CID | 14151587 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (4aS,10bR)-2,3,4,4a,5,10b-hexahydro-1H-chromeno[3,4-b]pyridin-7-ol |
| SMILES | Oc1cccc2c1OC[C@H]1NCCC[C@H]21 |
| InChI | InChI=1S/C12H15NO2/c14-11-5-1-3-9-8-4-2-6-13-10(8)7-15-12(9)11/h1,3,5,8,10,13-14H,2,4,6-7H2/t8-,10-/m1/s1 |
| InChIKey | PLTDSSAAMMFFRR-PSASIEDQSA-N |
| XLogP | 1.62 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |