C14H16N2 — CID 54508864
(7R)-6,11-diazatetracyclo[7.6.1.03,7.012,16]hexadeca-1(16),9,12,14-tetraene (PubChem CID 54508864) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is (7R)-6,11-diazatetracyclo[7.6.1.03,7.012,16]hexadeca-1(16),9,12,14-tetraene.
| Compound Name | (7R)-6,11-diazatetracyclo[7.6.1.03,7.012,16]hexadeca-1(16),9,12,14-tetraene |
|---|---|
| PubChem CID | 54508864 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (7R)-6,11-diazatetracyclo[7.6.1.03,7.012,16]hexadeca-1(16),9,12,14-tetraene |
| SMILES | c1cc2c3c(c[nH]c3c1)C[C@H]1NCCC1C2 |
| InChI | InChI=1S/C14H16N2/c1-2-10-6-9-4-5-15-13(9)7-11-8-16-12(3-1)14(10)11/h1-3,8-9,13,15-16H,4-7H2/t9?,13-/m1/s1 |
| InChIKey | YHRCKHJAKCAMEF-WCRCJTMVSA-N |
| XLogP | 2.24 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |