C12H15N — CID 86755477
(3aS,9aS)-2,3,3a,4,9,9a-hexahydro-1H-benzo[f]indole (PubChem CID 86755477) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is (3aS,9aS)-2,3,3a,4,9,9a-hexahydro-1H-benzo[f]indole.
| Compound Name | (3aS,9aS)-2,3,3a,4,9,9a-hexahydro-1H-benzo[f]indole |
|---|---|
| PubChem CID | 86755477 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (3aS,9aS)-2,3,3a,4,9,9a-hexahydro-1H-benzo[f]indole |
| SMILES | c1ccc2c(c1)C[C@H]1CCN[C@H]1C2 |
| InChI | InChI=1S/C12H15N/c1-2-4-10-8-12-11(5-6-13-12)7-9(10)3-1/h1-4,11-13H,5-8H2/t11-,12+/m1/s1 |
| InChIKey | REVUJGBPDQRBRB-NEPJUHHUSA-N |
| XLogP | 1.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |