C12H14BrN — CID 67193567
7-bromo-2,3,4,4a,9,9a-hexahydro-1H-indeno[2,1-b]pyridine (PubChem CID 67193567) has the molecular formula C12H14BrN and a molecular weight of 252.15 g/mol. Its IUPAC name is 7-bromo-2,3,4,4a,9,9a-hexahydro-1H-indeno[2,1-b]pyridine.
| Compound Name | 7-bromo-2,3,4,4a,9,9a-hexahydro-1H-indeno[2,1-b]pyridine |
|---|---|
| PubChem CID | 67193567 |
| Molecular Formula | C12H14BrN |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 7-bromo-2,3,4,4a,9,9a-hexahydro-1H-indeno[2,1-b]pyridine |
| SMILES | Brc1ccc2c(c1)CC1NCCCC21 |
| InChI | InChI=1S/C12H14BrN/c13-9-3-4-10-8(6-9)7-12-11(10)2-1-5-14-12/h3-4,6,11-12,14H,1-2,5,7H2 |
| InChIKey | LXFDOGUDPLUFCT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |