C12H19N — CID 123242636
5,6-di(ethylidene)-2,3,4,4a,7,7a-hexahydro-1H-cyclopenta[b]pyridine (PubChem CID 123242636) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 5,6-di(ethylidene)-2,3,4,4a,7,7a-hexahydro-1H-cyclopenta[b]pyridine.
| Compound Name | 5,6-di(ethylidene)-2,3,4,4a,7,7a-hexahydro-1H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 123242636 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 5,6-di(ethylidene)-2,3,4,4a,7,7a-hexahydro-1H-cyclopenta[b]pyridine |
| SMILES | CC=C1CC2NCCCC2C1=CC |
| InChI | InChI=1S/C12H19N/c1-3-9-8-12-11(10(9)4-2)6-5-7-13-12/h3-4,11-13H,5-8H2,1-2H3 |
| InChIKey | WPTMHGVFUOENHC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |